Products 949141-21-3

CAS 949141-21-3 is the registry number for Olopatadine Impurity 46. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[11-[3-(dimethylamino)propyl]-11-hydroxy-6H-benzo[c][1]benzoxepin-2-yl]acetic acid (CAS 949141-21-3) is a chemical compound with the molecular formula C21H25NO4 and a molecular weight of 355.4 g/mol. IUPAC name: 2-[11-[3-(dimethylamino)propyl]-11-hydroxy-6H-benzo[c][1]benzoxepin-2-yl]acetic acid. InChIKey: UUFGLFHAUFBCQT-UHFFFAOYSA-N.

Identity
Molecular formulaC21H25NO4
Molecular weight355.4 g/mol
IUPAC name2-[11-[3-(dimethylamino)propyl]-11-hydroxy-6H-benzo[c][1]benzoxepin-2-yl]acetic acid
InChIKeyUUFGLFHAUFBCQT-UHFFFAOYSA-N
SMILESCN(C)CCCC1(C2=CC=CC=C2COC3=C1C=C(C=C3)CC(=O)O)O

Computed by PubChem (NCBI)