CAS 94975-84-5 appears in our catalog under these names: 3-Methylquinoline-5-sulfonyl chloride, 97%, Argatroban Impurity 6, Argatroban Impurity 38. Offered by: Chemat Brand. Available pack sizes: on request.
3-methylquinoline-5-sulfonyl chloride (CAS 94975-84-5) is a chemical compound with the molecular formula C10H8ClNO2S and a molecular weight of 241.69 g/mol. IUPAC name: 3-methylquinoline-5-sulfonyl chloride. InChIKey: HTAMTFRQJZCNAH-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2S |
|---|---|
| Molecular weight | 241.69 g/mol |
| IUPAC name | 3-methylquinoline-5-sulfonyl chloride |
| InChIKey | HTAMTFRQJZCNAH-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=CC=C2S(=O)(=O)Cl)N=C1 |
Computed by PubChem (NCBI)