Products 949792-00-1
CAS 949792-00-1 is the registry number for HDAC8-IN-13. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-hydroxy-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-carboxamide (CAS 949792-00-1) is a chemical compound with the molecular formula C10H10N2O3S and a molecular weight of 238.27 g/mol. IUPAC name: N-hydroxy-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-carboxamide. InChIKey: IHRMVRSHVCKOFW-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O3S |
|---|---|
| Molecular weight | 238.27 g/mol |
| IUPAC name | N-hydroxy-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-carboxamide |
| InChIKey | IHRMVRSHVCKOFW-UHFFFAOYSA-N |
| SMILES | C1CSC2=C(C=C(C=C2)C(=O)NO)NC1=O |
Computed by PubChem (NCBI)