CAS 950029-05-7 is the registry number for 3-(4-Oxothieno(2,3-d)pyrimidin-3(4H)-yl)propanoic acid, 97%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
3-(4-oxothieno[2,3-d]pyrimidin-3-yl)propanoic acid (CAS 950029-05-7) is a chemical compound with the molecular formula C9H8N2O3S and a molecular weight of 224.24 g/mol. IUPAC name: 3-(4-oxothieno[2,3-d]pyrimidin-3-yl)propanoic acid. InChIKey: NUBXMHYBTKAZCZ-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3S |
|---|---|
| Molecular weight | 224.24 g/mol |
| IUPAC name | 3-(4-oxothieno[2,3-d]pyrimidin-3-yl)propanoic acid |
| InChIKey | NUBXMHYBTKAZCZ-UHFFFAOYSA-N |
| SMILES | C1=CSC2=C1C(=O)N(C=N2)CCC(=O)O |
Computed by PubChem (NCBI)