Products 95004-15-2
CAS 95004-15-2 appears in our catalog under these names: 2,4-Bis(1,1-dimethylethyl)-6-[(4-methoxyphenyl)amino]phenol, >95%, 2,4-Di-tert-Butyl-6-((4-methoxyphenyl)amino)phenol, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,4-ditert-butyl-6-(4-methoxyanilino)phenol (CAS 95004-15-2) is a chemical compound with the molecular formula C21H29NO2 and a molecular weight of 327.5 g/mol. IUPAC name: 2,4-ditert-butyl-6-(4-methoxyanilino)phenol. InChIKey: ISFKJKRYZKXCTP-UHFFFAOYSA-N.
| Molecular formula | C21H29NO2 |
|---|---|
| Molecular weight | 327.5 g/mol |
| IUPAC name | 2,4-ditert-butyl-6-(4-methoxyanilino)phenol |
| InChIKey | ISFKJKRYZKXCTP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)NC2=CC=C(C=C2)OC)O)C(C)(C)C |
Computed by PubChem (NCBI)