CAS 950233-83-7 is the registry number for 1-(4-Bromophenyl)-N-tert-butylmethanesulfonamide, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-(4-bromophenyl)-N-tert-butylmethanesulfonamide (CAS 950233-83-7) is a chemical compound with the molecular formula C11H16BrNO2S and a molecular weight of 306.22 g/mol. IUPAC name: 1-(4-bromophenyl)-N-tert-butylmethanesulfonamide. InChIKey: HZFYRMFTFIXBNA-UHFFFAOYSA-N.
| Molecular formula | C11H16BrNO2S |
|---|---|
| Molecular weight | 306.22 g/mol |
| IUPAC name | 1-(4-bromophenyl)-N-tert-butylmethanesulfonamide |
| InChIKey | HZFYRMFTFIXBNA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NS(=O)(=O)CC1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)