CAS 95061-46-4 appears in our catalog under these names: (R)–(+)–1,1,2–Triphenyl–1,2–ethanediol, (R)-(+)-1,1,2-Triphenyl-1,2-ethanediol, (R)-(+)-1,1,2-Triphenyl-1,2-ethanediol, >98.0%(GC), (R)-1,1,2-Triphenyl-1,2-ethanediol 98%, (R)-(+)-1,1,2-Triphenyl-1,2-ethanediol, 98%, 98%. Offered by: GLPBio, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: 1g, 5g, 2g, 10g, 25g, 250mg.
(2R)-1,1,2-triphenylethane-1,2-diol (CAS 95061-46-4) is a chemical compound with the molecular formula C20H18O2 and a molecular weight of 290.4 g/mol. IUPAC name: (2R)-1,1,2-triphenylethane-1,2-diol. InChIKey: GWVWUZJOQHWMFB-LJQANCHMSA-N.
| Molecular formula | C20H18O2 |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | (2R)-1,1,2-triphenylethane-1,2-diol |
| InChIKey | GWVWUZJOQHWMFB-LJQANCHMSA-N |
| SMILES | C1=CC=C(C=C1)[C@H](C(C2=CC=CC=C2)(C3=CC=CC=C3)O)O |
Computed by PubChem (NCBI)