Products 95093-55-3

CAS 95093-55-3 is the registry number for Mefenamic Acid 2,3-Butylene Glycol Ester. Offered by: Mikromol. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

3-hydroxybutan-2-yl 2-(2,3-dimethylanilino)benzoate (CAS 95093-55-3) is a chemical compound with the molecular formula C19H23NO3 and a molecular weight of 313.4 g/mol. IUPAC name: 3-hydroxybutan-2-yl 2-(2,3-dimethylanilino)benzoate. InChIKey: IQASIVZSXNHIIW-UHFFFAOYSA-N.

Identity
Molecular formulaC19H23NO3
Molecular weight313.4 g/mol
IUPAC name3-hydroxybutan-2-yl 2-(2,3-dimethylanilino)benzoate
InChIKeyIQASIVZSXNHIIW-UHFFFAOYSA-N
SMILESCC1=C(C(=CC=C1)NC2=CC=CC=C2C(=O)OC(C)C(C)O)C

Computed by PubChem (NCBI)