Products 951127-34-7
CAS 951127-34-7 is the registry number for tert-Butyl 3-acetyl-4-oxopyrrolidine-1-carboxylate, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-acetyl-4-oxopyrrolidine-1-carboxylate (CAS 951127-34-7) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: tert-butyl 3-acetyl-4-oxopyrrolidine-1-carboxylate. InChIKey: XTLYWJHJFOGWMF-UHFFFAOYSA-N.
| Molecular formula | C11H17NO4 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | tert-butyl 3-acetyl-4-oxopyrrolidine-1-carboxylate |
| InChIKey | XTLYWJHJFOGWMF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1CN(CC1=O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)