CAS 951885-08-8 appears in our catalog under these names: N-Cyclohexyl 5-bromopicolinamide, 95%, 5-Bromo-N-cyclohexylpicolinamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g.
5-bromo-N-cyclohexylpyridine-2-carboxamide (CAS 951885-08-8) is a chemical compound with the molecular formula C12H15BrN2O and a molecular weight of 283.16 g/mol. IUPAC name: 5-bromo-N-cyclohexylpyridine-2-carboxamide. InChIKey: OWCVMAFTYCTVBD-UHFFFAOYSA-N.
| Molecular formula | C12H15BrN2O |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | 5-bromo-N-cyclohexylpyridine-2-carboxamide |
| InChIKey | OWCVMAFTYCTVBD-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC(=O)C2=NC=C(C=C2)Br |
Computed by PubChem (NCBI)