Products 952343-40-7
CAS 952343-40-7 is the registry number for (3S,4R)-tert-butyl-3-hydroxy-4-phenylpyrrolidine-1- carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl (3S,4R)-3-hydroxy-4-phenylpyrrolidine-1-carboxylate;hydrochloride (CAS 952343-40-7) is a chemical compound with the molecular formula C15H22ClNO3 and a molecular weight of 299.79 g/mol. IUPAC name: tert-butyl (3S,4R)-3-hydroxy-4-phenylpyrrolidine-1-carboxylate;hydrochloride. InChIKey: SPCJGQMPMZFRST-JHEYCYPBSA-N.
| Molecular formula | C15H22ClNO3 |
|---|---|
| Molecular weight | 299.79 g/mol |
| IUPAC name | tert-butyl (3S,4R)-3-hydroxy-4-phenylpyrrolidine-1-carboxylate;hydrochloride |
| InChIKey | SPCJGQMPMZFRST-JHEYCYPBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@@H](C1)O)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)