Products 95261-87-3
CAS 95261-87-3 is the registry number for 5-(1,3-Dioxolan-2-yl)-2-fluorobenzenamine, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 100mg.
5-(1,3-dioxolan-2-yl)-2-fluoroaniline (CAS 95261-87-3) is a chemical compound with the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. IUPAC name: 5-(1,3-dioxolan-2-yl)-2-fluoroaniline. InChIKey: PQLZTGCFWDYSKJ-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO2 |
|---|---|
| Molecular weight | 183.18 g/mol |
| IUPAC name | 5-(1,3-dioxolan-2-yl)-2-fluoroaniline |
| InChIKey | PQLZTGCFWDYSKJ-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=CC(=C(C=C2)F)N |
Computed by PubChem (NCBI)