CAS 952958-78-0 is the registry number for 4-(2-Aminoethyl)-5-(2-furyl)isoxazol-3(2h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
4-(2-aminoethyl)-5-(furan-2-yl)-1,2-oxazol-3-one (CAS 952958-78-0) is a chemical compound with the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. IUPAC name: 4-(2-aminoethyl)-5-(furan-2-yl)-1,2-oxazol-3-one. InChIKey: OSALGMZBDFCSJY-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O3 |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | 4-(2-aminoethyl)-5-(furan-2-yl)-1,2-oxazol-3-one |
| InChIKey | OSALGMZBDFCSJY-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=C(C(=O)NO2)CCN |
Computed by PubChem (NCBI)