Products 953390-33-5
CAS 953390-33-5 is the registry number for 4-Chloro-6-nitrosoresorcinol-13C6. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
4-chloro-6-nitroso(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1,3-diol (CAS 953390-33-5) is a chemical compound with the molecular formula C6H4ClNO3 and a molecular weight of 179.51 g/mol. IUPAC name: 4-chloro-6-nitroso(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1,3-diol. InChIKey: JVTXZVVELSONAM-IDEBNGHGSA-N.
| Molecular formula | C6H4ClNO3 |
|---|---|
| Molecular weight | 179.51 g/mol |
| IUPAC name | 4-chloro-6-nitroso(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1,3-diol |
| InChIKey | JVTXZVVELSONAM-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13C]([13C](=[13CH][13C](=[13C]1Cl)O)O)N=O |
Computed by PubChem (NCBI)