Products 954134-92-0
CAS 954134-92-0 is the registry number for tert-Butyl N-((1-oxo-2,3-dihydro-1H-inden-5-yl)methyl)carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl N-[(1-oxo-2,3-dihydroinden-5-yl)methyl]carbamate (CAS 954134-92-0) is a chemical compound with the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. IUPAC name: tert-butyl N-[(1-oxo-2,3-dihydroinden-5-yl)methyl]carbamate. InChIKey: XSXYYZQXIQYNBK-UHFFFAOYSA-N.
| Molecular formula | C15H19NO3 |
|---|---|
| Molecular weight | 261.32 g/mol |
| IUPAC name | tert-butyl N-[(1-oxo-2,3-dihydroinden-5-yl)methyl]carbamate |
| InChIKey | XSXYYZQXIQYNBK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC2=C(C=C1)C(=O)CC2 |
Computed by PubChem (NCBI)