Products 954228-57-0

CAS 954228-57-0 is the registry number for 3-(Pyridin-4-yloxy)-piperidine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl 3-pyridin-4-yloxypiperidine-1-carboxylate (CAS 954228-57-0) is a chemical compound with the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. IUPAC name: tert-butyl 3-pyridin-4-yloxypiperidine-1-carboxylate. InChIKey: AREYBAUQIHNEEM-UHFFFAOYSA-N.

Identity
Molecular formulaC15H22N2O3
Molecular weight278.35 g/mol
IUPAC nametert-butyl 3-pyridin-4-yloxypiperidine-1-carboxylate
InChIKeyAREYBAUQIHNEEM-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCC(C1)OC2=CC=NC=C2

Computed by PubChem (NCBI)