Products 954236-03-4
CAS 954236-03-4 is the registry number for 2-Bromo-1-(difluoromethoxy)-4-(trifluoromethyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-bromo-1-(difluoromethoxy)-4-(trifluoromethyl)benzene (CAS 954236-03-4) is a chemical compound with the molecular formula C8H4BrF5O and a molecular weight of 291.01 g/mol. IUPAC name: 2-bromo-1-(difluoromethoxy)-4-(trifluoromethyl)benzene. InChIKey: HAZRZLQTNWLTNL-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF5O |
|---|---|
| Molecular weight | 291.01 g/mol |
| IUPAC name | 2-bromo-1-(difluoromethoxy)-4-(trifluoromethyl)benzene |
| InChIKey | HAZRZLQTNWLTNL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Br)OC(F)F |
Computed by PubChem (NCBI)