CAS 6669-01-8 is the registry number for 2-(Pentafluorophenoxy)ethylbromide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2-bromoethoxy)-2,3,4,5,6-pentafluorobenzene (CAS 6669-01-8) is a chemical compound with the molecular formula C8H4BrF5O and a molecular weight of 291.01 g/mol. IUPAC name: 1-(2-bromoethoxy)-2,3,4,5,6-pentafluorobenzene. InChIKey: DZKOVQHPLXTXML-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF5O |
|---|---|
| Molecular weight | 291.01 g/mol |
| IUPAC name | 1-(2-bromoethoxy)-2,3,4,5,6-pentafluorobenzene |
| InChIKey | DZKOVQHPLXTXML-UHFFFAOYSA-N |
| SMILES | C(CBr)OC1=C(C(=C(C(=C1F)F)F)F)F |
Computed by PubChem (NCBI)