CAS 2504201-96-9 is the registry number for 1-Bromo-2,3-difluoro-4-(2,2,2-trifluoroethoxy)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-bromo-2,3-difluoro-4-(2,2,2-trifluoroethoxy)benzene (CAS 2504201-96-9) is a chemical compound with the molecular formula C8H4BrF5O and a molecular weight of 291.01 g/mol. IUPAC name: 1-bromo-2,3-difluoro-4-(2,2,2-trifluoroethoxy)benzene. InChIKey: GGZQFPYMZBYHST-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF5O |
|---|---|
| Molecular weight | 291.01 g/mol |
| IUPAC name | 1-bromo-2,3-difluoro-4-(2,2,2-trifluoroethoxy)benzene |
| InChIKey | GGZQFPYMZBYHST-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1OCC(F)(F)F)F)F)Br |
Computed by PubChem (NCBI)