CAS 59935-56-7 appears in our catalog under these names: 1-Bromo-3-(1,1,2,2,2-pentafluoroethoxy)benzene, 95%, 1-Bromo-3-(1,1,2,2,2-pentafluoroethoxy)benzene stabilized over potassium carbonate, 98%, 1-Bromo-3-(1,1,2,2,2-pentafluoroethoxy)benzene. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
1-bromo-3-(1,1,2,2,2-pentafluoroethoxy)benzene (CAS 59935-56-7) is a chemical compound with the molecular formula C8H4BrF5O and a molecular weight of 291.01 g/mol. IUPAC name: 1-bromo-3-(1,1,2,2,2-pentafluoroethoxy)benzene. InChIKey: NTLDIVRYEZEFTO-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF5O |
|---|---|
| Molecular weight | 291.01 g/mol |
| IUPAC name | 1-bromo-3-(1,1,2,2,2-pentafluoroethoxy)benzene |
| InChIKey | NTLDIVRYEZEFTO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)OC(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)