CAS 95450-49-0 is the registry number for Methyl (2,3,5-trimethylphenoxy)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 2-(2,3,5-trimethylphenoxy)acetate (CAS 95450-49-0) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: methyl 2-(2,3,5-trimethylphenoxy)acetate. InChIKey: LLUWVSXMVBOUFY-UHFFFAOYSA-N.
| Molecular formula | C12H16O3 |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | methyl 2-(2,3,5-trimethylphenoxy)acetate |
| InChIKey | LLUWVSXMVBOUFY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)OCC(=O)OC)C)C |
Computed by PubChem (NCBI)