Products 955-97-5
CAS 955-97-5 appears in our catalog under these names: 4-Amino-N-(4-chlorophenyl)benzamide 97%, (4-Aminophenyl)-N-(4-chlorophenyl)formamide. Offered by: Ambeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 500mg, 1000mg.
4-amino-N-(4-chlorophenyl)benzamide (CAS 955-97-5) is a chemical compound with the molecular formula C13H11ClN2O and a molecular weight of 246.69 g/mol. IUPAC name: 4-amino-N-(4-chlorophenyl)benzamide. InChIKey: ODKZAVMWGNJMIA-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2O |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | 4-amino-N-(4-chlorophenyl)benzamide |
| InChIKey | ODKZAVMWGNJMIA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NC2=CC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)