CAS 955406-75-4 is the registry number for 4-Oxo-4,5,6,7-tetrahydro-indazole-1-carboxylic acid tert-butyl ester hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl 4-oxo-6,7-dihydro-5H-indazole-1-carboxylate (CAS 955406-75-4) is a chemical compound with the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. IUPAC name: tert-butyl 4-oxo-6,7-dihydro-5H-indazole-1-carboxylate. InChIKey: GGZGEHFMODUSAW-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O3 |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | tert-butyl 4-oxo-6,7-dihydro-5H-indazole-1-carboxylate |
| InChIKey | GGZGEHFMODUSAW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=C(C=N1)C(=O)CCC2 |
Computed by PubChem (NCBI)