CAS 95541-32-5 appears in our catalog under these names: 6-Bromo-2,3-dimethyl-1,4-dihydroquinolin-4-one, 95%, 6-Bromo-2,3-dimethyl-1,4-dihydroquinolin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
6-bromo-2,3-dimethyl-1H-quinolin-4-one (CAS 95541-32-5) is a chemical compound with the molecular formula C11H10BrNO and a molecular weight of 252.11 g/mol. IUPAC name: 6-bromo-2,3-dimethyl-1H-quinolin-4-one. InChIKey: PLTYVUKHSKAXBC-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO |
|---|---|
| Molecular weight | 252.11 g/mol |
| IUPAC name | 6-bromo-2,3-dimethyl-1H-quinolin-4-one |
| InChIKey | PLTYVUKHSKAXBC-UHFFFAOYSA-N |
| SMILES | CC1=C(NC2=C(C1=O)C=C(C=C2)Br)C |
Computed by PubChem (NCBI)