CAS 956034-43-8 appears in our catalog under these names: 2,2-Dimethyl-1-(methylsulfonyl)piperazine hydrochloride, 2,2-Dimethyl-1-(methylsulfonyl)piperazine hydrochloride, 97%, 97%, 1-Methylsulfonyl-2,2-dimethylpiperazine hydrochloride, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g.
2,2-dimethyl-1-methylsulfonylpiperazine;hydrochloride (CAS 956034-43-8) is a chemical compound with the molecular formula C7H17ClN2O2S and a molecular weight of 228.74 g/mol. IUPAC name: 2,2-dimethyl-1-methylsulfonylpiperazine;hydrochloride. InChIKey: SIQQDDDFTPLXAK-UHFFFAOYSA-N.
| Molecular formula | C7H17ClN2O2S |
|---|---|
| Molecular weight | 228.74 g/mol |
| IUPAC name | 2,2-dimethyl-1-methylsulfonylpiperazine;hydrochloride |
| InChIKey | SIQQDDDFTPLXAK-UHFFFAOYSA-N |
| SMILES | CC1(CNCCN1S(=O)(=O)C)C.Cl |
Computed by PubChem (NCBI)