Products 95632-87-4
CAS 95632-87-4 is the registry number for (Z)-3-Hexen-1-yl b-D-glucopyranoside. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 500mg.
(2R,3R,4S,5S,6R)-2-[(E)-hex-3-enoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 95632-87-4) is a chemical compound with the molecular formula C12H22O6 and a molecular weight of 262.30 g/mol. IUPAC name: (2R,3R,4S,5S,6R)-2-[(E)-hex-3-enoxy]-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: OZIPFYKAIOOVEJ-WQPBHKFLSA-N.
| Molecular formula | C12H22O6 |
|---|---|
| Molecular weight | 262.30 g/mol |
| IUPAC name | (2R,3R,4S,5S,6R)-2-[(E)-hex-3-enoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | OZIPFYKAIOOVEJ-WQPBHKFLSA-N |
| SMILES | CC/C=C/CCO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)