CAS 956699-05-1 is the registry number for cis-2,6-Dimethyl-4-(5-nitropyridin-2-yl)morpholine, 97%. Offered by: AmBeed. Available pack sizes: 1g.
(2R,6S)-2,6-dimethyl-4-(5-nitro-2-pyridinyl)morpholine (CAS 956699-05-1) is a chemical compound with the molecular formula C11H15N3O3 and a molecular weight of 237.25 g/mol. IUPAC name: (2R,6S)-2,6-dimethyl-4-(5-nitro-2-pyridinyl)morpholine. InChIKey: OEWWQMFPALMWEF-DTORHVGOSA-N.
| Molecular formula | C11H15N3O3 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | (2R,6S)-2,6-dimethyl-4-(5-nitro-2-pyridinyl)morpholine |
| InChIKey | OEWWQMFPALMWEF-DTORHVGOSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](O1)C)C2=NC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)