Products 956930-31-7

CAS 956930-31-7 is the registry number for 1-(2-Fluorophenyl)-3,5-dimethyl-1h-pyrazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

1-(2-fluorophenyl)-3,5-dimethylpyrazole-4-carboxylic acid (CAS 956930-31-7) is a chemical compound with the molecular formula C12H11FN2O2 and a molecular weight of 234.23 g/mol. IUPAC name: 1-(2-fluorophenyl)-3,5-dimethylpyrazole-4-carboxylic acid. InChIKey: OSYBBCSASBLDBC-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11FN2O2
Molecular weight234.23 g/mol
IUPAC name1-(2-fluorophenyl)-3,5-dimethylpyrazole-4-carboxylic acid
InChIKeyOSYBBCSASBLDBC-UHFFFAOYSA-N
SMILESCC1=C(C(=NN1C2=CC=CC=C2F)C)C(=O)O

Computed by PubChem (NCBI)