Products 957065-98-4
CAS 957065-98-4 is the registry number for 2-(3-Bromophenyl)-5-cyclohexyl-1,3,4-oxadiazole, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(3-bromophenyl)-5-cyclohexyl-1,3,4-oxadiazole (CAS 957065-98-4) is a chemical compound with the molecular formula C14H15BrN2O and a molecular weight of 307.19 g/mol. IUPAC name: 2-(3-bromophenyl)-5-cyclohexyl-1,3,4-oxadiazole. InChIKey: AALHXJNIVDMMFQ-UHFFFAOYSA-N.
| Molecular formula | C14H15BrN2O |
|---|---|
| Molecular weight | 307.19 g/mol |
| IUPAC name | 2-(3-bromophenyl)-5-cyclohexyl-1,3,4-oxadiazole |
| InChIKey | AALHXJNIVDMMFQ-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=NN=C(O2)C3=CC(=CC=C3)Br |
Computed by PubChem (NCBI)