CAS 443106-68-1 is the registry number for 3-(4-Bromophenyl)-5-cyclohexyl-1,2,4-oxadiazole, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-(4-bromophenyl)-5-cyclohexyl-1,2,4-oxadiazole (CAS 443106-68-1) is a chemical compound with the molecular formula C14H15BrN2O and a molecular weight of 307.19 g/mol. IUPAC name: 3-(4-bromophenyl)-5-cyclohexyl-1,2,4-oxadiazole. InChIKey: HVKDKLNQUZYYAJ-UHFFFAOYSA-N.
| Molecular formula | C14H15BrN2O |
|---|---|
| Molecular weight | 307.19 g/mol |
| IUPAC name | 3-(4-bromophenyl)-5-cyclohexyl-1,2,4-oxadiazole |
| InChIKey | HVKDKLNQUZYYAJ-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=NC(=NO2)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)