CAS 2131199-80-7 is the registry number for 2-((Benzyloxy)methyl)-5-bromo-4,6-dimethylpyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-4,6-dimethyl-2-(phenylmethoxymethyl)pyrimidine (CAS 2131199-80-7) is a chemical compound with the molecular formula C14H15BrN2O and a molecular weight of 307.19 g/mol. IUPAC name: 5-bromo-4,6-dimethyl-2-(phenylmethoxymethyl)pyrimidine. InChIKey: SMHACTVDGBCGPM-UHFFFAOYSA-N.
| Molecular formula | C14H15BrN2O |
|---|---|
| Molecular weight | 307.19 g/mol |
| IUPAC name | 5-bromo-4,6-dimethyl-2-(phenylmethoxymethyl)pyrimidine |
| InChIKey | SMHACTVDGBCGPM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=N1)COCC2=CC=CC=C2)C)Br |
Computed by PubChem (NCBI)