CAS 1281833-75-7 appears in our catalog under these names: 2-Bromo-1-N-[(4-methoxyphenyl)methyl]benzene-1,4-diamine, 95%, 2-Bromo-1-N-((4-methoxyphenyl)methyl)benzene-1,4-diamine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
2-bromo-1-N-[(4-methoxyphenyl)methyl]benzene-1,4-diamine (CAS 1281833-75-7) is a chemical compound with the molecular formula C14H15BrN2O and a molecular weight of 307.19 g/mol. IUPAC name: 2-bromo-1-N-[(4-methoxyphenyl)methyl]benzene-1,4-diamine. InChIKey: CAEODVMETXWOFD-UHFFFAOYSA-N.
| Molecular formula | C14H15BrN2O |
|---|---|
| Molecular weight | 307.19 g/mol |
| IUPAC name | 2-bromo-1-N-[(4-methoxyphenyl)methyl]benzene-1,4-diamine |
| InChIKey | CAEODVMETXWOFD-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CNC2=C(C=C(C=C2)N)Br |
Computed by PubChem (NCBI)