CAS 95716-01-1 appears in our catalog under these names: 2-((((Benzyloxy)carbonyl)amino)methyl)thiazole-4-carboxylic acid, 97%, 97%, 2-((((Benzyloxy)carbonyl)amino)methyl)thiazole-4-carboxylic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 500mg.
2-(phenylmethoxycarbonylaminomethyl)-1,3-thiazole-4-carboxylic acid (CAS 95716-01-1) is a chemical compound with the molecular formula C13H12N2O4S and a molecular weight of 292.31 g/mol. IUPAC name: 2-(phenylmethoxycarbonylaminomethyl)-1,3-thiazole-4-carboxylic acid. InChIKey: AYCIUPBAVNJVOA-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O4S |
|---|---|
| Molecular weight | 292.31 g/mol |
| IUPAC name | 2-(phenylmethoxycarbonylaminomethyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | AYCIUPBAVNJVOA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCC2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)