CAS 957290-76-5 is the registry number for 3-(3,5-Dimethyl-pyrazol-1-yl)-4-fluoro-benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3,5-dimethylpyrazol-1-yl)-4-fluorobenzoic acid (CAS 957290-76-5) is a chemical compound with the molecular formula C12H11FN2O2 and a molecular weight of 234.23 g/mol. IUPAC name: 3-(3,5-dimethylpyrazol-1-yl)-4-fluorobenzoic acid. InChIKey: JOBXEHUVOYPOLN-UHFFFAOYSA-N.
| Molecular formula | C12H11FN2O2 |
|---|---|
| Molecular weight | 234.23 g/mol |
| IUPAC name | 3-(3,5-dimethylpyrazol-1-yl)-4-fluorobenzoic acid |
| InChIKey | JOBXEHUVOYPOLN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=C(C=CC(=C2)C(=O)O)F)C |
Computed by PubChem (NCBI)