Products 957290-76-5

CAS 957290-76-5 is the registry number for 3-(3,5-Dimethyl-pyrazol-1-yl)-4-fluoro-benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(3,5-dimethylpyrazol-1-yl)-4-fluorobenzoic acid (CAS 957290-76-5) is a chemical compound with the molecular formula C12H11FN2O2 and a molecular weight of 234.23 g/mol. IUPAC name: 3-(3,5-dimethylpyrazol-1-yl)-4-fluorobenzoic acid. InChIKey: JOBXEHUVOYPOLN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11FN2O2
Molecular weight234.23 g/mol
IUPAC name3-(3,5-dimethylpyrazol-1-yl)-4-fluorobenzoic acid
InChIKeyJOBXEHUVOYPOLN-UHFFFAOYSA-N
SMILESCC1=CC(=NN1C2=C(C=CC(=C2)C(=O)O)F)C

Computed by PubChem (NCBI)