Products 95773-32-3
CAS 95773-32-3 is the registry number for 1-(2,4-Dimethylphenyl)quinazolin-4(1H)-one. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
1-(2,4-dimethylphenyl)quinazolin-4-one (CAS 95773-32-3) is a chemical compound with the molecular formula C16H14N2O and a molecular weight of 250.29 g/mol. IUPAC name: 1-(2,4-dimethylphenyl)quinazolin-4-one. InChIKey: FZENVXTXCPUULF-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | 1-(2,4-dimethylphenyl)quinazolin-4-one |
| InChIKey | FZENVXTXCPUULF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N2C=NC(=O)C3=CC=CC=C32)C |
Computed by PubChem (NCBI)