CAS 95857-32-2 is the registry number for 1-(4-Nitrophenyl)pentane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-nitro-4-pentylbenzene (CAS 95857-32-2) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: 1-nitro-4-pentylbenzene. InChIKey: ZHXFSPASCJVKKA-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 1-nitro-4-pentylbenzene |
| InChIKey | ZHXFSPASCJVKKA-UHFFFAOYSA-N |
| SMILES | CCCCCC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)