Products 958649-84-8
CAS 958649-84-8 is the registry number for 1,4-Benzenedicarboxylic acid, 1,4-bis(4-aMino-2-Methylphenyl) ester, >97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Bis(4-amino-2-methylphenyl) benzene-1,4-dicarboxylate (CAS 958649-84-8) is a chemical compound with the molecular formula C22H20N2O4 and a molecular weight of 376.4 g/mol. IUPAC name: bis(4-amino-2-methylphenyl) benzene-1,4-dicarboxylate. InChIKey: XSQRYCPTYSGRJK-UHFFFAOYSA-N.
| Molecular formula | C22H20N2O4 |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | bis(4-amino-2-methylphenyl) benzene-1,4-dicarboxylate |
| InChIKey | XSQRYCPTYSGRJK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N)OC(=O)C2=CC=C(C=C2)C(=O)OC3=C(C=C(C=C3)N)C |
Computed by PubChem (NCBI)