CAS 959-52-4 appears in our catalog under these names: 1,3,5–Triacryloylhexahydro–1,3,5–triazine, 1,3,5-Triacryloylhexahydro-1,3,5-triazine, 1,3,5-Triacryloylhexahydro-1,3,5-triazine, >98.0%(HPLC)(N), 1,3,5-Triacryloylhexahydro-1,3,5-triazine 98%, 1,3,5-TRIACRYLOYLHEXAHYDRO-1,3,5-TRIAZI&. Offered by: GLPBio, Biosynth, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 100g, 0,25kg, 0,1kg, 25g, 500g, 0,5kg, 1kg, 2kg.
1-[3,5-di(prop-2-enoyl)-1,3,5-triazinan-1-yl]prop-2-en-1-one (CAS 959-52-4) is a chemical compound with the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. IUPAC name: 1-[3,5-di(prop-2-enoyl)-1,3,5-triazinan-1-yl]prop-2-en-1-one. InChIKey: FYBFGAFWCBMEDG-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O3 |
|---|---|
| Molecular weight | 249.27 g/mol |
| IUPAC name | 1-[3,5-di(prop-2-enoyl)-1,3,5-triazinan-1-yl]prop-2-en-1-one |
| InChIKey | FYBFGAFWCBMEDG-UHFFFAOYSA-N |
| SMILES | C=CC(=O)N1CN(CN(C1)C(=O)C=C)C(=O)C=C |
Computed by PubChem (NCBI)