CAS 959137-40-7 appears in our catalog under these names: (2-Amino-4-chlorophenyl)(cyclopentyl)methanone, 98%, (2-Amino-4-chlorophenyl)cyclopentylmethanone. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
(2-amino-4-chlorophenyl)-cyclopentylmethanone (CAS 959137-40-7) is a chemical compound with the molecular formula C12H14ClNO and a molecular weight of 223.70 g/mol. IUPAC name: (2-amino-4-chlorophenyl)-cyclopentylmethanone. InChIKey: HCOXXJFTVJXUNA-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO |
|---|---|
| Molecular weight | 223.70 g/mol |
| IUPAC name | (2-amino-4-chlorophenyl)-cyclopentylmethanone |
| InChIKey | HCOXXJFTVJXUNA-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)C(=O)C2=C(C=C(C=C2)Cl)N |
Computed by PubChem (NCBI)