CAS 959574-79-9 is the registry number for 2-(2,2-dimethyl(3-oxaindan-4-yloxy))acetylhydrazide. Offered by: Biosynth. Available pack sizes: 250mg.
2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetohydrazide (CAS 959574-79-9) is a chemical compound with the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. IUPAC name: 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetohydrazide. InChIKey: CNERWUNALVDUEW-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O3 |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetohydrazide |
| InChIKey | CNERWUNALVDUEW-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(O1)C(=CC=C2)OCC(=O)NN)C |
Computed by PubChem (NCBI)