Products 959577-31-2
CAS 959577-31-2 appears in our catalog under these names: 2-Chloro-6-(dimethylamino)nicotinic acid, 98%, 2-Chloro-6-(dimethylamino)pyridine-3-carboxylic acid, 98%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
2-chloro-6-(dimethylamino)pyridine-3-carboxylic acid (CAS 959577-31-2) is a chemical compound with the molecular formula C8H9ClN2O2 and a molecular weight of 200.62 g/mol. IUPAC name: 2-chloro-6-(dimethylamino)pyridine-3-carboxylic acid. InChIKey: KCELKMBUYRXARZ-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O2 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 2-chloro-6-(dimethylamino)pyridine-3-carboxylic acid |
| InChIKey | KCELKMBUYRXARZ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC(=C(C=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)