Products 959842-28-5
CAS 959842-28-5 is the registry number for 5-Bromo-2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridine, 98%. Offered by: Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridine (CAS 959842-28-5) is a chemical compound with the molecular formula C9H9BrF3N and a molecular weight of 268.07 g/mol. IUPAC name: 5-bromo-2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridine. InChIKey: RCDHVVQGFZWCPA-UHFFFAOYSA-N.
| Molecular formula | C9H9BrF3N |
|---|---|
| Molecular weight | 268.07 g/mol |
| IUPAC name | 5-bromo-2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridine |
| InChIKey | RCDHVVQGFZWCPA-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=NC=C(C=C1)Br)C(F)(F)F |
Computed by PubChem (NCBI)