CAS 96-73-1 appears in our catalog under these names: 2-Chloro-5-nitrobenzenesulfonic acid, 98%, 2-Chloro-5-nitro-benzenesulfonic acid. Offered by: AmBeed, Biosynth, Fluorochem. Available pack sizes: 1g, 25g.
2-chloro-5-nitrobenzenesulfonic acid (CAS 96-73-1) is a chemical compound with the molecular formula C6H4ClNO5S and a molecular weight of 237.62 g/mol. IUPAC name: 2-chloro-5-nitrobenzenesulfonic acid. InChIKey: GNTARUIZNIWBCN-UHFFFAOYSA-N.
| Molecular formula | C6H4ClNO5S |
|---|---|
| Molecular weight | 237.62 g/mol |
| IUPAC name | 2-chloro-5-nitrobenzenesulfonic acid |
| InChIKey | GNTARUIZNIWBCN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])S(=O)(=O)O)Cl |
Computed by PubChem (NCBI)