Products 960589-81-5
CAS 960589-81-5 is the registry number for Ent-17-hydroxykauran-3-one. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote.
(1S,4S,9S,10R,13R,14S)-14-(hydroxymethyl)-5,5,9-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecan-6-one (CAS 960589-81-5) is a chemical compound with the molecular formula C20H32O2 and a molecular weight of 304.5 g/mol. IUPAC name: (1S,4S,9S,10R,13R,14S)-14-(hydroxymethyl)-5,5,9-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecan-6-one. InChIKey: LHTFWLIJEYMGTO-ILRNBGBRSA-N.
| Molecular formula | C20H32O2 |
|---|---|
| Molecular weight | 304.5 g/mol |
| IUPAC name | (1S,4S,9S,10R,13R,14S)-14-(hydroxymethyl)-5,5,9-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecan-6-one |
| InChIKey | LHTFWLIJEYMGTO-ILRNBGBRSA-N |
| SMILES | C[C@@]12CCC(=O)C([C@H]1CC[C@]34[C@H]2CC[C@H](C3)[C@H](C4)CO)(C)C |
Computed by PubChem (NCBI)