Products 96100-31-1

CAS 96100-31-1 is the registry number for 2-Acetyl-4-methylbenzoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-acetyl-4-methylbenzoic acid (CAS 96100-31-1) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 2-acetyl-4-methylbenzoic acid. InChIKey: OFSIURTYYPSEJK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10O3
Molecular weight178.18 g/mol
IUPAC name2-acetyl-4-methylbenzoic acid
InChIKeyOFSIURTYYPSEJK-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)C(=O)O)C(=O)C

Computed by PubChem (NCBI)