CAS 96100-31-1 is the registry number for 2-Acetyl-4-methylbenzoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-acetyl-4-methylbenzoic acid (CAS 96100-31-1) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 2-acetyl-4-methylbenzoic acid. InChIKey: OFSIURTYYPSEJK-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 2-acetyl-4-methylbenzoic acid |
| InChIKey | OFSIURTYYPSEJK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)O)C(=O)C |
Computed by PubChem (NCBI)