Products 96443-55-9
CAS 96443-55-9 is the registry number for Cladospolide B. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3Z,5S,6S,12S)-5,6-dihydroxy-12-methyl-1-oxacyclododec-3-en-2-one (CAS 96443-55-9) is a chemical compound with the molecular formula C12H20O4 and a molecular weight of 228.28 g/mol. IUPAC name: (3Z,5S,6S,12S)-5,6-dihydroxy-12-methyl-1-oxacyclododec-3-en-2-one. InChIKey: PLHJPQNLCWFPFY-VQPFVQDKSA-N.
| Molecular formula | C12H20O4 |
|---|---|
| Molecular weight | 228.28 g/mol |
| IUPAC name | (3Z,5S,6S,12S)-5,6-dihydroxy-12-methyl-1-oxacyclododec-3-en-2-one |
| InChIKey | PLHJPQNLCWFPFY-VQPFVQDKSA-N |
| SMILES | C[C@H]1CCCCC[C@@H]([C@H](/C=C\C(=O)O1)O)O |
Computed by PubChem (NCBI)