CAS 96756-28-4 appears in our catalog under these names: 2',4',6'-Trihydroxy-3'-propylacetophenone, 95%, 2',4',6'-TRIHYDROXY-3'-PROPYLACETOPHENONE, ≥95%, 2',4',6'-Trihydroxy-3'-propylacetophenone, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 50mg.
1-(2,4,6-trihydroxy-3-propylphenyl)ethanone (CAS 96756-28-4) is a chemical compound with the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. IUPAC name: 1-(2,4,6-trihydroxy-3-propylphenyl)ethanone. InChIKey: GAMMIJNCCUGNGJ-UHFFFAOYSA-N.
| Molecular formula | C11H14O4 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 1-(2,4,6-trihydroxy-3-propylphenyl)ethanone |
| InChIKey | GAMMIJNCCUGNGJ-UHFFFAOYSA-N |
| SMILES | CCCC1=C(C(=C(C=C1O)O)C(=O)C)O |
Computed by PubChem (NCBI)