Products 96951-89-2
CAS 96951-89-2 is the registry number for Exo-benzyl 3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (1S,5R)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate (CAS 96951-89-2) is a chemical compound with the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. IUPAC name: benzyl (1S,5R)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate. InChIKey: AXRYOOOSGBBQPJ-PBWFPOADSA-N.
| Molecular formula | C15H19NO3 |
|---|---|
| Molecular weight | 261.32 g/mol |
| IUPAC name | benzyl (1S,5R)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate |
| InChIKey | AXRYOOOSGBBQPJ-PBWFPOADSA-N |
| SMILES | C1C[C@H]2CC(C[C@@H]1N2C(=O)OCC3=CC=CC=C3)O |
Computed by PubChem (NCBI)