CAS 97-52-9 appears in our catalog under these names: 2-Methoxy-4-nitroaniline, 98%, 2-Methoxy-4-nitroaniline, >95% (HPLC), 2-Methoxy-4-nitroaniline, 2-Methoxy-4-nitroaniline, 99% , 2-Methoxy-4-nitroaniline, >99.0%(GC). Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer, Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros). Available pack sizes: 100g, 1kg, 25g, 5g, 500g, 100mg, 1x1000mg.
2-methoxy-4-nitroaniline (CAS 97-52-9) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 2-methoxy-4-nitroaniline. InChIKey: GVBHRNIWBGTNQA-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 2-methoxy-4-nitroaniline |
| InChIKey | GVBHRNIWBGTNQA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)