Products 97024-60-7

CAS 97024-60-7 is the registry number for 3-((5,6,7,8-Tetrahydronaphthalen-2-yl)oxy)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propanoic acid (CAS 97024-60-7) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: 3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propanoic acid. InChIKey: GEFNBOHVAWDWSV-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16O3
Molecular weight220.26 g/mol
IUPAC name3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propanoic acid
InChIKeyGEFNBOHVAWDWSV-UHFFFAOYSA-N
SMILESC1CCC2=C(C1)C=CC(=C2)OCCC(=O)O

Computed by PubChem (NCBI)